C11H20O3S2 — CID 135062102
(R)-cyclohexyl-[(1R,3R)-1,3-dioxo-1,3-dithian-2-yl]methanol (PubChem CID 135062102) has the molecular formula C11H20O3S2 and a molecular weight of 264.41 g/mol. Its IUPAC name is (R)-cyclohexyl-[(1R,3R)-1,3-dioxo-1,3-dithian-2-yl]methanol.
| Compound Name | (R)-cyclohexyl-[(1R,3R)-1,3-dioxo-1,3-dithian-2-yl]methanol |
|---|---|
| PubChem CID | 135062102 |
| Molecular Formula | C11H20O3S2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | (R)-cyclohexyl-[(1R,3R)-1,3-dioxo-1,3-dithian-2-yl]methanol |
| SMILES | O=[S@@]1CCC[S@@](=O)C1[C@H](O)C1CCCCC1 |
| InChI | InChI=1S/C11H20O3S2/c12-10(9-5-2-1-3-6-9)11-15(13)7-4-8-16(11)14/h9-12H,1-8H2/t10-,15-,16-/m1/s1 |
| InChIKey | ZDLVASURBZCKFB-UHNFBRDESA-N |
| XLogP | 1.15 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |