C23H19FO4S2 — CID 135062248
[5,5-bis(benzenesulfonyl)-5-fluoropenta-1,2-dienyl]benzene (PubChem CID 135062248) has the molecular formula C23H19FO4S2 and a molecular weight of 442.53 g/mol. Its IUPAC name is [5,5-bis(benzenesulfonyl)-5-fluoropenta-1,2-dienyl]benzene.
| Compound Name | [5,5-bis(benzenesulfonyl)-5-fluoropenta-1,2-dienyl]benzene |
|---|---|
| PubChem CID | 135062248 |
| Molecular Formula | C23H19FO4S2 |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | [5,5-bis(benzenesulfonyl)-5-fluoropenta-1,2-dienyl]benzene |
| SMILES | O=S(=O)(c1ccccc1)C(F)(CC=C=Cc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H19FO4S2/c24-23(29(25,26)21-15-6-2-7-16-21,30(27,28)22-17-8-3-9-18-22)19-11-10-14-20-12-4-1-5-13-20/h1-9,11-18H,19H2 |
| InChIKey | VWRAHDNHIPMNBM-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |