C24H21FO5S2 — CID 135062258
1-[5,5-bis(benzenesulfonyl)-5-fluoropenta-1,2-dienyl]-4-methoxybenzene (PubChem CID 135062258) has the molecular formula C24H21FO5S2 and a molecular weight of 472.56 g/mol. Its IUPAC name is 1-[5,5-bis(benzenesulfonyl)-5-fluoropenta-1,2-dienyl]-4-methoxybenzene.
| Compound Name | 1-[5,5-bis(benzenesulfonyl)-5-fluoropenta-1,2-dienyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 135062258 |
| Molecular Formula | C24H21FO5S2 |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | 1-[5,5-bis(benzenesulfonyl)-5-fluoropenta-1,2-dienyl]-4-methoxybenzene |
| SMILES | COc1ccc(C=C=CCC(F)(S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21FO5S2/c1-30-21-17-15-20(16-18-21)10-8-9-19-24(25,31(26,27)22-11-4-2-5-12-22)32(28,29)23-13-6-3-7-14-23/h2-7,9-18H,19H2,1H3 |
| InChIKey | WDQXUJOFWPDIBX-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |