C22H47BO4Si2 — CID 135062814
tert-butyl-[(Z)-4-[dimethyl(propan-2-yloxy)silyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoxy]-dimethylsilane (PubChem CID 135062814) has the molecular formula C22H47BO4Si2 and a molecular weight of 442.60 g/mol. Its IUPAC name is tert-butyl-[(Z)-4-[dimethyl(propan-2-yloxy)silyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z)-4-[dimethyl(propan-2-yloxy)silyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 135062814 |
| Molecular Formula | C22H47BO4Si2 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | tert-butyl-[(Z)-4-[dimethyl(propan-2-yloxy)silyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoxy]-dimethylsilane |
| SMILES | CC(C)O[Si](C)(C)/C(=C\B1OC(C)(C)C(C)(C)O1)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H47BO4Si2/c1-18(2)25-28(10,11)19(15-14-16-24-29(12,13)20(3,4)5)17-23-26-21(6,7)22(8,9)27-23/h17-18H,14-16H2,1-13H3/b19-17- |
| InChIKey | MQTAJYLYFCESNU-ZPHPHTNESA-N |
| XLogP | 6.52 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|