C21H18F6N2O — CID 135062998
(1Z)-N-(6-methyl-2-phenyl-2,3,4,5-tetrahydropyridin-1-ium-1-yl)-3,5-bis(trifluoromethyl)benzenecarboximidate (PubChem CID 135062998) has the molecular formula C21H18F6N2O and a molecular weight of 428.38 g/mol. Its IUPAC name is (1Z)-N-(6-methyl-2-phenyl-2,3,4,5-tetrahydropyridin-1-ium-1-yl)-3,5-bis(trifluoromethyl)benzenecarboximidate.
| Compound Name | (1Z)-N-(6-methyl-2-phenyl-2,3,4,5-tetrahydropyridin-1-ium-1-yl)-3,5-bis(trifluoromethyl)benzenecarboximidate |
|---|---|
| PubChem CID | 135062998 |
| Molecular Formula | C21H18F6N2O |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | (1Z)-N-(6-methyl-2-phenyl-2,3,4,5-tetrahydropyridin-1-ium-1-yl)-3,5-bis(trifluoromethyl)benzenecarboximidate |
| SMILES | CC1=[N+](/N=C(\[O-])c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(c2ccccc2)CCC1 |
| InChI | InChI=1S/C21H18F6N2O/c1-13-6-5-9-18(14-7-3-2-4-8-14)29(13)28-19(30)15-10-16(20(22,23)24)12-17(11-15)21(25,26)27/h2-4,7-8,10-12,18H,5-6,9H2,1H3 |
| InChIKey | BAVXHLNQHACDLU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|