About (3E)-3-[(2-chlorophenyl)methylidene]-4-aza-3-azoniatricyclo[5.2.1.02,6]dec-4-en-5-olate
(3E)-3-[(2-chlorophenyl)methylidene]-4-aza-3-azoniatricyclo[5.2.1.02,6]dec-4-en-5-olate (PubChem CID 135063002) has the molecular formula C15H15ClN2O
and a molecular weight of 274.75 g/mol. Its IUPAC name is (3E)-3-[(2-chlorophenyl)methylidene]-4-aza-3-azoniatricyclo[5.2.1.02,6]dec-4-en-5-olate.
Molecular Properties
| Compound Name | (3E)-3-[(2-chlorophenyl)methylidene]-4-aza-3-azoniatricyclo[5.2.1.02,6]dec-4-en-5-olate |
| PubChem CID | 135063002 |
| Molecular Formula | C15H15ClN2O |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | (3E)-3-[(2-chlorophenyl)methylidene]-4-aza-3-azoniatricyclo[5.2.1.02,6]dec-4-en-5-olate |
| SMILES | [O-]C1=N/[N+](=C/c2ccccc2Cl)C2C3CCC(C3)C12 |
| InChI | InChI=1S/C15H15ClN2O/c16-12-4-2-1-3-11(12)8-18-14-10-6-5-9(7-10)13(14)15(19)17-18/h1-4,8-10,13-14H,5-7H2/b18-8+ |
| InChIKey | HHIPABOPDOFWFY-QGMBQPNBSA-N |
| XLogP | 1.87 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-[(2-chlorophenyl)methylidene]-4-aza-3-azoniatricyclo[5.2.1.02,6]dec-4-en-5-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-[(2-chlorophenyl)methylidene]-4-aza-3-azoniatricyclo[5.2.1.02,6]dec-4-en-5-olate?
The IUPAC name of (3E)-3-[(2-chlorophenyl)methylidene]-4-aza-3-azoniatricyclo[5.2.1.02,6]dec-4-en-5-olate (CID 135063002) is (3E)-3-[(2-chlorophenyl)methylidene]-4-aza-3-azoniatricyclo[5.2.1.02,6]dec-4-en-5-olate.
What is the SMILES notation for (3E)-3-[(2-chlorophenyl)methylidene]-4-aza-3-azoniatricyclo[5.2.1.02,6]dec-4-en-5-olate?
The canonical SMILES for (3E)-3-[(2-chlorophenyl)methylidene]-4-aza-3-azoniatricyclo[5.2.1.02,6]dec-4-en-5-olate is [O-]C1=N/[N+](=C/c2ccccc2Cl)C2C3CCC(C3)C12.
What is the InChIKey of (3E)-3-[(2-chlorophenyl)methylidene]-4-aza-3-azoniatricyclo[5.2.1.02,6]dec-4-en-5-olate?
The InChIKey is HHIPABOPDOFWFY-QGMBQPNBSA-N. The full InChI is InChI=1S/C15H15ClN2O/c16-12-4-2-1-3-11(12)8-18-14-10-6-5-9(7-10)13(14)15(19)17-18/h1-4,8-10,13-14H,5-7H2/b18-8+.
What are the key properties of (3E)-3-[(2-chlorophenyl)methylidene]-4-aza-3-azoniatricyclo[5.2.1.02,6]dec-4-en-5-olate?
(3E)-3-[(2-chlorophenyl)methylidene]-4-aza-3-azoniatricyclo[5.2.1.02,6]dec-4-en-5-olate has a molecular weight of 274.75 g/mol, XLogP of 1.87, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-[(2-chlorophenyl)methylidene]-4-aza-3-azoniatricyclo[5.2.1.02,6]dec-4-en-5-olate is sourced from PubChem (CID 135063002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).