C19H31NO3Si — CID 135063146
methyl (2R,3S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-methyl-2,3-dihydroindole-1-carboxylate (PubChem CID 135063146) has the molecular formula C19H31NO3Si and a molecular weight of 349.55 g/mol. Its IUPAC name is methyl (2R,3S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-methyl-2,3-dihydroindole-1-carboxylate.
| Compound Name | methyl (2R,3S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-methyl-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 135063146 |
| Molecular Formula | C19H31NO3Si |
| Molecular Weight | 349.55 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | methyl (2R,3S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-methyl-2,3-dihydroindole-1-carboxylate |
| SMILES | COC(=O)N1c2ccccc2[C@H](CCO[Si](C)(C)C(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C19H31NO3Si/c1-14-15(12-13-23-24(6,7)19(2,3)4)16-10-8-9-11-17(16)20(14)18(21)22-5/h8-11,14-15H,12-13H2,1-7H3/t14-,15-/m1/s1 |
| InChIKey | UBBDRQGWTKHOMN-HUUCEWRRSA-N |
| XLogP | 5.16 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.55 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|