About (1-cyclohexylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate
(1-cyclohexylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate (PubChem CID 135063157) has the molecular formula C14H15F3N2O3S
and a molecular weight of 348.35 g/mol. Its IUPAC name is (1-cyclohexylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (1-cyclohexylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate |
| PubChem CID | 135063157 |
| Molecular Formula | C14H15F3N2O3S |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | (1-cyclohexylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2ccn(C3CCCCC3)c2n1)C(F)(F)F |
| InChI | InChI=1S/C14H15F3N2O3S/c15-14(16,17)23(20,21)22-12-7-6-10-8-9-19(13(10)18-12)11-4-2-1-3-5-11/h6-9,11H,1-5H2 |
| InChIKey | UEHOPRFFCXXQMH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (1-cyclohexylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyclohexylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate?
The IUPAC name of (1-cyclohexylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate (CID 135063157) is (1-cyclohexylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate.
What is the SMILES notation for (1-cyclohexylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate?
The canonical SMILES for (1-cyclohexylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate is O=S(=O)(Oc1ccc2ccn(C3CCCCC3)c2n1)C(F)(F)F.
What is the InChIKey of (1-cyclohexylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate?
The InChIKey is UEHOPRFFCXXQMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F3N2O3S/c15-14(16,17)23(20,21)22-12-7-6-10-8-9-19(13(10)18-12)11-4-2-1-3-5-11/h6-9,11H,1-5H2.
What are the key properties of (1-cyclohexylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate?
(1-cyclohexylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate has a molecular weight of 348.35 g/mol, XLogP of 3.77, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyclohexylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate is sourced from PubChem (CID 135063157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).