C23H23F6N2O+ — CID 135063227
N-[6-[(3,5-dimethylphenyl)methyl]-2,3,4,5-tetrahydropyridin-1-ium-1-yl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 135063227) has the molecular formula C23H23F6N2O+ and a molecular weight of 457.44 g/mol. Its IUPAC name is N-[6-[(3,5-dimethylphenyl)methyl]-2,3,4,5-tetrahydropyridin-1-ium-1-yl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[6-[(3,5-dimethylphenyl)methyl]-2,3,4,5-tetrahydropyridin-1-ium-1-yl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 135063227 |
| Molecular Formula | C23H23F6N2O+ |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | N-[6-[(3,5-dimethylphenyl)methyl]-2,3,4,5-tetrahydropyridin-1-ium-1-yl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | Cc1cc(C)cc(CC2=[N+](NC(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)CCCC2)c1 |
| InChI | InChI=1S/C23H22F6N2O/c1-14-7-15(2)9-16(8-14)10-20-5-3-4-6-31(20)30-21(32)17-11-18(22(24,25)26)13-19(12-17)23(27,28)29/h7-9,11-13H,3-6,10H2,1-2H3/p+1 |
| InChIKey | QMDQUKDOKMDDGF-UHFFFAOYSA-O |
| XLogP | 5.87 |
| TPSA | 32.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|