About (1-tert-butylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate
(1-tert-butylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate (PubChem CID 135063374) has the molecular formula C12H13F3N2O3S
and a molecular weight of 322.31 g/mol. Its IUPAC name is (1-tert-butylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (1-tert-butylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate |
| PubChem CID | 135063374 |
| Molecular Formula | C12H13F3N2O3S |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | (1-tert-butylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate |
| SMILES | CC(C)(C)n1ccc2ccc(OS(=O)(=O)C(F)(F)F)nc21 |
| InChI | InChI=1S/C12H13F3N2O3S/c1-11(2,3)17-7-6-8-4-5-9(16-10(8)17)20-21(18,19)12(13,14)15/h4-7H,1-3H3 |
| InChIKey | KAGGCPKFWBHDSK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (1-tert-butylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-tert-butylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate?
The IUPAC name of (1-tert-butylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate (CID 135063374) is (1-tert-butylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate.
What is the SMILES notation for (1-tert-butylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate?
The canonical SMILES for (1-tert-butylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate is CC(C)(C)n1ccc2ccc(OS(=O)(=O)C(F)(F)F)nc21.
What is the InChIKey of (1-tert-butylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate?
The InChIKey is KAGGCPKFWBHDSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F3N2O3S/c1-11(2,3)17-7-6-8-4-5-9(16-10(8)17)20-21(18,19)12(13,14)15/h4-7H,1-3H3.
What are the key properties of (1-tert-butylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate?
(1-tert-butylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate has a molecular weight of 322.31 g/mol, XLogP of 3.02, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-tert-butylpyrrolo[2,3-b]pyridin-6-yl) trifluoromethanesulfonate is sourced from PubChem (CID 135063374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).