C11H16N2 — CID 135063395
1-[(1E,3E)-3-ethylhexa-1,3-dienyl]pyrazole (PubChem CID 135063395) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 1-[(1E,3E)-3-ethylhexa-1,3-dienyl]pyrazole.
| Compound Name | 1-[(1E,3E)-3-ethylhexa-1,3-dienyl]pyrazole |
|---|---|
| PubChem CID | 135063395 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 1-[(1E,3E)-3-ethylhexa-1,3-dienyl]pyrazole |
| SMILES | CC/C=C(/C=C/n1cccn1)CC |
| InChI | InChI=1S/C11H16N2/c1-3-6-11(4-2)7-10-13-9-5-8-12-13/h5-10H,3-4H2,1-2H3/b10-7+,11-6+ |
| InChIKey | BTQJVDGMEPQLMD-NXAIOARDSA-N |
| XLogP | 3.10 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|