C12H12N2O4S2 — CID 135063435
2-[(2R,3R)-1,4-dinitro-3-thiophen-2-ylbutan-2-yl]thiophene (PubChem CID 135063435) has the molecular formula C12H12N2O4S2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-[(2R,3R)-1,4-dinitro-3-thiophen-2-ylbutan-2-yl]thiophene.
| Compound Name | 2-[(2R,3R)-1,4-dinitro-3-thiophen-2-ylbutan-2-yl]thiophene |
|---|---|
| PubChem CID | 135063435 |
| Molecular Formula | C12H12N2O4S2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 2-[(2R,3R)-1,4-dinitro-3-thiophen-2-ylbutan-2-yl]thiophene |
| SMILES | O=[N+]([O-])C[C@H](c1cccs1)[C@H](C[N+](=O)[O-])c1cccs1 |
| InChI | InChI=1S/C12H12N2O4S2/c15-13(16)7-9(11-3-1-5-19-11)10(8-14(17)18)12-4-2-6-20-12/h1-6,9-10H,7-8H2/t9-,10-/m0/s1 |
| InChIKey | QCNPELGFEODQRL-UWVGGRQHSA-N |
| XLogP | 3.23 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|