C43H49NO5SSi — CID 135063482
tert-butyl-[2-[(2S,3R,4S)-1-(4-methylphenyl)sulfonyl-3-phenylmethoxy-4-(phenylmethoxymethyl)azetidin-2-yl]ethoxy]-diphenylsilane (PubChem CID 135063482) has the molecular formula C43H49NO5SSi and a molecular weight of 720.02 g/mol. Its IUPAC name is tert-butyl-[2-[(2S,3R,4S)-1-(4-methylphenyl)sulfonyl-3-phenylmethoxy-4-(phenylmethoxymethyl)azetidin-2-yl]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[(2S,3R,4S)-1-(4-methylphenyl)sulfonyl-3-phenylmethoxy-4-(phenylmethoxymethyl)azetidin-2-yl]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 135063482 |
| Molecular Formula | C43H49NO5SSi |
| Molecular Weight | 720.02 g/mol |
| Exact Mass | 719.31 |
| IUPAC Name | tert-butyl-[2-[(2S,3R,4S)-1-(4-methylphenyl)sulfonyl-3-phenylmethoxy-4-(phenylmethoxymethyl)azetidin-2-yl]ethoxy]-diphenylsilane |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@@H](CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H](OCc3ccccc3)[C@@H]2COCc2ccccc2)cc1 |
| InChI | InChI=1S/C43H49NO5SSi/c1-34-25-27-37(28-26-34)50(45,46)44-40(29-30-49-51(43(2,3)4,38-21-13-7-14-22-38)39-23-15-8-16-24-39)42(48-32-36-19-11-6-12-20-36)41(44)33-47-31-35-17-9-5-10-18-35/h5-28,40-42H,29-33H2,1-4H3/t40-,41-,42+/m0/s1 |
| InChIKey | ASWKVNDIRFZUOK-WTQYMLSTSA-N |
| XLogP | 7.51 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.02 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|