C18H14FNO4 — CID 135063629
methyl (2R)-2-(1,3-dioxoisoindol-2-yl)-3-fluoro-3-phenylpropanoate (PubChem CID 135063629) has the molecular formula C18H14FNO4 and a molecular weight of 327.31 g/mol. Its IUPAC name is methyl (2R)-2-(1,3-dioxoisoindol-2-yl)-3-fluoro-3-phenylpropanoate.
| Compound Name | methyl (2R)-2-(1,3-dioxoisoindol-2-yl)-3-fluoro-3-phenylpropanoate |
|---|---|
| PubChem CID | 135063629 |
| Molecular Formula | C18H14FNO4 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | methyl (2R)-2-(1,3-dioxoisoindol-2-yl)-3-fluoro-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](C(F)c1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H14FNO4/c1-24-18(23)15(14(19)11-7-3-2-4-8-11)20-16(21)12-9-5-6-10-13(12)17(20)22/h2-10,14-15H,1H3/t14?,15-/m0/s1 |
| InChIKey | QIKADVUKTJKFKV-LOACHALJSA-N |
| XLogP | 2.54 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|