About (2S,3S)-3-bromo-2-chloro-3,7-dimethyloct-6-en-1-ol
(2S,3S)-3-bromo-2-chloro-3,7-dimethyloct-6-en-1-ol (PubChem CID 135063657) has the molecular formula C10H18BrClO
and a molecular weight of 269.61 g/mol. Its IUPAC name is (2S,3S)-3-bromo-2-chloro-3,7-dimethyloct-6-en-1-ol.
Molecular Properties
| Compound Name | (2S,3S)-3-bromo-2-chloro-3,7-dimethyloct-6-en-1-ol |
| PubChem CID | 135063657 |
| Molecular Formula | C10H18BrClO |
| Molecular Weight | 269.61 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | (2S,3S)-3-bromo-2-chloro-3,7-dimethyloct-6-en-1-ol |
| SMILES | CC(C)=CCC[C@](C)(Br)[C@@H](Cl)CO |
| InChI | InChI=1S/C10H18BrClO/c1-8(2)5-4-6-10(3,11)9(12)7-13/h5,9,13H,4,6-7H2,1-3H3/t9-,10-/m0/s1 |
| InChIKey | JFCCRMODCSQUFB-UWVGGRQHSA-N |
| XLogP | 3.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.61 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S,3S)-3-bromo-2-chloro-3,7-dimethyloct-6-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-3-bromo-2-chloro-3,7-dimethyloct-6-en-1-ol?
The IUPAC name of (2S,3S)-3-bromo-2-chloro-3,7-dimethyloct-6-en-1-ol (CID 135063657) is (2S,3S)-3-bromo-2-chloro-3,7-dimethyloct-6-en-1-ol.
What is the SMILES notation for (2S,3S)-3-bromo-2-chloro-3,7-dimethyloct-6-en-1-ol?
The canonical SMILES for (2S,3S)-3-bromo-2-chloro-3,7-dimethyloct-6-en-1-ol is CC(C)=CCC[C@](C)(Br)[C@@H](Cl)CO.
What is the InChIKey of (2S,3S)-3-bromo-2-chloro-3,7-dimethyloct-6-en-1-ol?
The InChIKey is JFCCRMODCSQUFB-UWVGGRQHSA-N. The full InChI is InChI=1S/C10H18BrClO/c1-8(2)5-4-6-10(3,11)9(12)7-13/h5,9,13H,4,6-7H2,1-3H3/t9-,10-/m0/s1.
What are the key properties of (2S,3S)-3-bromo-2-chloro-3,7-dimethyloct-6-en-1-ol?
(2S,3S)-3-bromo-2-chloro-3,7-dimethyloct-6-en-1-ol has a molecular weight of 269.61 g/mol, XLogP of 3.49, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-3-bromo-2-chloro-3,7-dimethyloct-6-en-1-ol is sourced from PubChem (CID 135063657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).