C15H16N6O4S2 — CID 135063681
3-[[3-(3-sulfamoylanilino)-1H-pyrazol-5-yl]amino]benzenesulfonamide (PubChem CID 135063681) has the molecular formula C15H16N6O4S2 and a molecular weight of 408.47 g/mol. Its IUPAC name is 3-[[3-(3-sulfamoylanilino)-1H-pyrazol-5-yl]amino]benzenesulfonamide.
| Compound Name | 3-[[3-(3-sulfamoylanilino)-1H-pyrazol-5-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 135063681 |
| Molecular Formula | C15H16N6O4S2 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 3-[[3-(3-sulfamoylanilino)-1H-pyrazol-5-yl]amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(Nc2cc(Nc3cccc(S(N)(=O)=O)c3)[nH]n2)c1 |
| InChI | InChI=1S/C15H16N6O4S2/c16-26(22,23)12-5-1-3-10(7-12)18-14-9-15(21-20-14)19-11-4-2-6-13(8-11)27(17,24)25/h1-9H,(H2,16,22,23)(H2,17,24,25)(H3,18,19,20,21) |
| InChIKey | NRZOKJPHIPPTSD-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 173.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |