C21H26N4O6 — CID 135064255
3-N,5-N-bis(3,4,5-trimethoxyphenyl)-1H-pyrazole-3,5-diamine (PubChem CID 135064255) has the molecular formula C21H26N4O6 and a molecular weight of 430.46 g/mol. Its IUPAC name is 3-N,5-N-bis(3,4,5-trimethoxyphenyl)-1H-pyrazole-3,5-diamine.
| Compound Name | 3-N,5-N-bis(3,4,5-trimethoxyphenyl)-1H-pyrazole-3,5-diamine |
|---|---|
| PubChem CID | 135064255 |
| Molecular Formula | C21H26N4O6 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 3-N,5-N-bis(3,4,5-trimethoxyphenyl)-1H-pyrazole-3,5-diamine |
| SMILES | COc1cc(Nc2cc(Nc3cc(OC)c(OC)c(OC)c3)[nH]n2)cc(OC)c1OC |
| InChI | InChI=1S/C21H26N4O6/c1-26-14-7-12(8-15(27-2)20(14)30-5)22-18-11-19(25-24-18)23-13-9-16(28-3)21(31-6)17(10-13)29-4/h7-11H,1-6H3,(H3,22,23,24,25) |
| InChIKey | RNAAQTGDFXESER-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |