C33H31BrN2O3S — CID 135064385
N-(4-bromophenyl)sulfonyl-2-(2-butyl-1-methylindol-3-yl)-N,2-diphenylacetamide (PubChem CID 135064385) has the molecular formula C33H31BrN2O3S and a molecular weight of 615.59 g/mol. Its IUPAC name is N-(4-bromophenyl)sulfonyl-2-(2-butyl-1-methylindol-3-yl)-N,2-diphenylacetamide.
| Compound Name | N-(4-bromophenyl)sulfonyl-2-(2-butyl-1-methylindol-3-yl)-N,2-diphenylacetamide |
|---|---|
| PubChem CID | 135064385 |
| Molecular Formula | C33H31BrN2O3S |
| Molecular Weight | 615.59 g/mol |
| Exact Mass | 614.12 |
| IUPAC Name | N-(4-bromophenyl)sulfonyl-2-(2-butyl-1-methylindol-3-yl)-N,2-diphenylacetamide |
| SMILES | CCCCc1c(C(C(=O)N(c2ccccc2)S(=O)(=O)c2ccc(Br)cc2)c2ccccc2)c2ccccc2n1C |
| InChI | InChI=1S/C33H31BrN2O3S/c1-3-4-18-30-32(28-17-11-12-19-29(28)35(30)2)31(24-13-7-5-8-14-24)33(37)36(26-15-9-6-10-16-26)40(38,39)27-22-20-25(34)21-23-27/h5-17,19-23,31H,3-4,18H2,1-2H3 |
| InChIKey | HZQUISKJNRPZDP-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.59 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|