C21H24N2O4S2 — CID 135064491
3,5-diethyl-1,4-bis-(4-methylphenyl)sulfonylpyrazole (PubChem CID 135064491) has the molecular formula C21H24N2O4S2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 3,5-diethyl-1,4-bis-(4-methylphenyl)sulfonylpyrazole.
| Compound Name | 3,5-diethyl-1,4-bis-(4-methylphenyl)sulfonylpyrazole |
|---|---|
| PubChem CID | 135064491 |
| Molecular Formula | C21H24N2O4S2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 3,5-diethyl-1,4-bis-(4-methylphenyl)sulfonylpyrazole |
| SMILES | CCc1nn(S(=O)(=O)c2ccc(C)cc2)c(CC)c1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H24N2O4S2/c1-5-19-21(28(24,25)17-11-7-15(3)8-12-17)20(6-2)23(22-19)29(26,27)18-13-9-16(4)10-14-18/h7-14H,5-6H2,1-4H3 |
| InChIKey | CXKLORMPCQNIPP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 86.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |