C21H14BrNOS — CID 135064569
(3'S,4R)-3'-bromo-2-phenylspiro[3,1-benzoxazine-4,2'-3H-1-benzothiophene] (PubChem CID 135064569) has the molecular formula C21H14BrNOS and a molecular weight of 408.32 g/mol. Its IUPAC name is (3'S,4R)-3'-bromo-2-phenylspiro[3,1-benzoxazine-4,2'-3H-1-benzothiophene].
| Compound Name | (3'S,4R)-3'-bromo-2-phenylspiro[3,1-benzoxazine-4,2'-3H-1-benzothiophene] |
|---|---|
| PubChem CID | 135064569 |
| Molecular Formula | C21H14BrNOS |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 407.00 |
| IUPAC Name | (3'S,4R)-3'-bromo-2-phenylspiro[3,1-benzoxazine-4,2'-3H-1-benzothiophene] |
| SMILES | Br[C@H]1c2ccccc2S[C@@]12OC(c1ccccc1)=Nc1ccccc12 |
| InChI | InChI=1S/C21H14BrNOS/c22-19-15-10-4-7-13-18(15)25-21(19)16-11-5-6-12-17(16)23-20(24-21)14-8-2-1-3-9-14/h1-13,19H/t19-,21+/m0/s1 |
| InChIKey | QIDHHFZZXYZHEJ-PZJWPPBQSA-N |
| XLogP | 6.19 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|