About 2-phenylselanylpenta-1,4-dienylidenecyclododecane
2-phenylselanylpenta-1,4-dienylidenecyclododecane (PubChem CID 135064611) has the molecular formula C23H32Se
and a molecular weight of 387.47 g/mol. Its IUPAC name is 2-phenylselanylpenta-1,4-dienylidenecyclododecane.
Molecular Properties
| Compound Name | 2-phenylselanylpenta-1,4-dienylidenecyclododecane |
| PubChem CID | 135064611 |
| Molecular Formula | C23H32Se |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 2-phenylselanylpenta-1,4-dienylidenecyclododecane |
| SMILES | C=CCC(=C=C1CCCCCCCCCCC1)[Se]c1ccccc1 |
| InChI | InChI=1S/C23H32Se/c1-2-15-23(24-22-18-13-10-14-19-22)20-21-16-11-8-6-4-3-5-7-9-12-17-21/h2,10,13-14,18-19H,1,3-9,11-12,15-17H2 |
| InChIKey | DYZKBFSWNBKGNJ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylselanylpenta-1,4-dienylidenecyclododecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylselanylpenta-1,4-dienylidenecyclododecane?
The IUPAC name of 2-phenylselanylpenta-1,4-dienylidenecyclododecane (CID 135064611) is 2-phenylselanylpenta-1,4-dienylidenecyclododecane.
What is the SMILES notation for 2-phenylselanylpenta-1,4-dienylidenecyclododecane?
The canonical SMILES for 2-phenylselanylpenta-1,4-dienylidenecyclododecane is C=CCC(=C=C1CCCCCCCCCCC1)[Se]c1ccccc1.
What is the InChIKey of 2-phenylselanylpenta-1,4-dienylidenecyclododecane?
The InChIKey is DYZKBFSWNBKGNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H32Se/c1-2-15-23(24-22-18-13-10-14-19-22)20-21-16-11-8-6-4-3-5-7-9-12-17-21/h2,10,13-14,18-19H,1,3-9,11-12,15-17H2.
What are the key properties of 2-phenylselanylpenta-1,4-dienylidenecyclododecane?
2-phenylselanylpenta-1,4-dienylidenecyclododecane has a molecular weight of 387.47 g/mol, XLogP of 6.31, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylselanylpenta-1,4-dienylidenecyclododecane is sourced from PubChem (CID 135064611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).