About (1S,3R)-3-(fluoromethyl)-2-(4-methylphenyl)sulfonyl-1,3-diphenyl-1H-isoindole
(1S,3R)-3-(fluoromethyl)-2-(4-methylphenyl)sulfonyl-1,3-diphenyl-1H-isoindole (PubChem CID 135064653) has the molecular formula C28H24FNO2S
and a molecular weight of 457.57 g/mol. Its IUPAC name is (1S,3R)-3-(fluoromethyl)-2-(4-methylphenyl)sulfonyl-1,3-diphenyl-1H-isoindole.
Molecular Properties
| Compound Name | (1S,3R)-3-(fluoromethyl)-2-(4-methylphenyl)sulfonyl-1,3-diphenyl-1H-isoindole |
| PubChem CID | 135064653 |
| Molecular Formula | C28H24FNO2S |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | (1S,3R)-3-(fluoromethyl)-2-(4-methylphenyl)sulfonyl-1,3-diphenyl-1H-isoindole |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@@H](c3ccccc3)c3ccccc3[C@@]2(CF)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24FNO2S/c1-21-16-18-24(19-17-21)33(31,32)30-27(22-10-4-2-5-11-22)25-14-8-9-15-26(25)28(30,20-29)23-12-6-3-7-13-23/h2-19,27H,20H2,1H3/t27-,28+/m0/s1 |
| InChIKey | OPNORDUHARJXBV-WUFINQPMSA-N |
| XLogP | 6.00 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S,3R)-3-(fluoromethyl)-2-(4-methylphenyl)sulfonyl-1,3-diphenyl-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,3R)-3-(fluoromethyl)-2-(4-methylphenyl)sulfonyl-1,3-diphenyl-1H-isoindole?
The IUPAC name of (1S,3R)-3-(fluoromethyl)-2-(4-methylphenyl)sulfonyl-1,3-diphenyl-1H-isoindole (CID 135064653) is (1S,3R)-3-(fluoromethyl)-2-(4-methylphenyl)sulfonyl-1,3-diphenyl-1H-isoindole.
What is the SMILES notation for (1S,3R)-3-(fluoromethyl)-2-(4-methylphenyl)sulfonyl-1,3-diphenyl-1H-isoindole?
The canonical SMILES for (1S,3R)-3-(fluoromethyl)-2-(4-methylphenyl)sulfonyl-1,3-diphenyl-1H-isoindole is Cc1ccc(S(=O)(=O)N2[C@@H](c3ccccc3)c3ccccc3[C@@]2(CF)c2ccccc2)cc1.
What is the InChIKey of (1S,3R)-3-(fluoromethyl)-2-(4-methylphenyl)sulfonyl-1,3-diphenyl-1H-isoindole?
The InChIKey is OPNORDUHARJXBV-WUFINQPMSA-N. The full InChI is InChI=1S/C28H24FNO2S/c1-21-16-18-24(19-17-21)33(31,32)30-27(22-10-4-2-5-11-22)25-14-8-9-15-26(25)28(30,20-29)23-12-6-3-7-13-23/h2-19,27H,20H2,1H3/t27-,28+/m0/s1.
What are the key properties of (1S,3R)-3-(fluoromethyl)-2-(4-methylphenyl)sulfonyl-1,3-diphenyl-1H-isoindole?
(1S,3R)-3-(fluoromethyl)-2-(4-methylphenyl)sulfonyl-1,3-diphenyl-1H-isoindole has a molecular weight of 457.57 g/mol, XLogP of 6.00, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,3R)-3-(fluoromethyl)-2-(4-methylphenyl)sulfonyl-1,3-diphenyl-1H-isoindole is sourced from PubChem (CID 135064653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).