C14H19NO3S — CID 135064775
(2S)-4,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine-2-carbaldehyde (PubChem CID 135064775) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is (2S)-4,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine-2-carbaldehyde.
| Compound Name | (2S)-4,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 135064775 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | (2S)-4,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine-2-carbaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(C)(C)C[C@H]2C=O)cc1 |
| InChI | InChI=1S/C14H19NO3S/c1-11-4-6-13(7-5-11)19(17,18)15-10-14(2,3)8-12(15)9-16/h4-7,9,12H,8,10H2,1-3H3/t12-/m0/s1 |
| InChIKey | YTUBAANRKRHKDW-LBPRGKRZSA-N |
| XLogP | 1.98 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|