About tert-butyl N-[(1S)-2,2-difluoro-1-(3-methylphenyl)-3-oxo-3-phenylpropyl]carbamate
tert-butyl N-[(1S)-2,2-difluoro-1-(3-methylphenyl)-3-oxo-3-phenylpropyl]carbamate (PubChem CID 135064944) has the molecular formula C21H23F2NO3
and a molecular weight of 375.42 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2,2-difluoro-1-(3-methylphenyl)-3-oxo-3-phenylpropyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(1S)-2,2-difluoro-1-(3-methylphenyl)-3-oxo-3-phenylpropyl]carbamate |
| PubChem CID | 135064944 |
| Molecular Formula | C21H23F2NO3 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | tert-butyl N-[(1S)-2,2-difluoro-1-(3-methylphenyl)-3-oxo-3-phenylpropyl]carbamate |
| SMILES | Cc1cccc([C@H](NC(=O)OC(C)(C)C)C(F)(F)C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C21H23F2NO3/c1-14-9-8-12-16(13-14)17(24-19(26)27-20(2,3)4)21(22,23)18(25)15-10-6-5-7-11-15/h5-13,17H,1-4H3,(H,24,26)/t17-/m0/s1 |
| InChIKey | XMCCDAQOODXTOX-KRWDZBQOSA-N |
| XLogP | 5.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl N-[(1S)-2,2-difluoro-1-(3-methylphenyl)-3-oxo-3-phenylpropyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(1S)-2,2-difluoro-1-(3-methylphenyl)-3-oxo-3-phenylpropyl]carbamate?
The IUPAC name of tert-butyl N-[(1S)-2,2-difluoro-1-(3-methylphenyl)-3-oxo-3-phenylpropyl]carbamate (CID 135064944) is tert-butyl N-[(1S)-2,2-difluoro-1-(3-methylphenyl)-3-oxo-3-phenylpropyl]carbamate.
What is the SMILES notation for tert-butyl N-[(1S)-2,2-difluoro-1-(3-methylphenyl)-3-oxo-3-phenylpropyl]carbamate?
The canonical SMILES for tert-butyl N-[(1S)-2,2-difluoro-1-(3-methylphenyl)-3-oxo-3-phenylpropyl]carbamate is Cc1cccc([C@H](NC(=O)OC(C)(C)C)C(F)(F)C(=O)c2ccccc2)c1.
What is the InChIKey of tert-butyl N-[(1S)-2,2-difluoro-1-(3-methylphenyl)-3-oxo-3-phenylpropyl]carbamate?
The InChIKey is XMCCDAQOODXTOX-KRWDZBQOSA-N. The full InChI is InChI=1S/C21H23F2NO3/c1-14-9-8-12-16(13-14)17(24-19(26)27-20(2,3)4)21(22,23)18(25)15-10-6-5-7-11-15/h5-13,17H,1-4H3,(H,24,26)/t17-/m0/s1.
What are the key properties of tert-butyl N-[(1S)-2,2-difluoro-1-(3-methylphenyl)-3-oxo-3-phenylpropyl]carbamate?
tert-butyl N-[(1S)-2,2-difluoro-1-(3-methylphenyl)-3-oxo-3-phenylpropyl]carbamate has a molecular weight of 375.42 g/mol, XLogP of 5.08, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(1S)-2,2-difluoro-1-(3-methylphenyl)-3-oxo-3-phenylpropyl]carbamate is sourced from PubChem (CID 135064944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).