C16H31BO2 — CID 135065031
2-(1-cyclohexylbutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 135065031) has the molecular formula C16H31BO2 and a molecular weight of 266.23 g/mol. Its IUPAC name is 2-(1-cyclohexylbutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(1-cyclohexylbutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 135065031 |
| Molecular Formula | C16H31BO2 |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 2-(1-cyclohexylbutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCC(B1OC(C)(C)C(C)(C)O1)C1CCCCC1 |
| InChI | InChI=1S/C16H31BO2/c1-6-10-14(13-11-8-7-9-12-13)17-18-15(2,3)16(4,5)19-17/h13-14H,6-12H2,1-5H3 |
| InChIKey | HDGRGZIIUIPMHE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|