C24H24O7 — CID 135065168
2-[2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-4-methoxy-6-[(E)-3-oxo-3-phenylmethoxyprop-1-enyl]phenyl]acetic acid (PubChem CID 135065168) has the molecular formula C24H24O7 and a molecular weight of 424.45 g/mol. Its IUPAC name is 2-[2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-4-methoxy-6-[(E)-3-oxo-3-phenylmethoxyprop-1-enyl]phenyl]acetic acid.
| Compound Name | 2-[2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-4-methoxy-6-[(E)-3-oxo-3-phenylmethoxyprop-1-enyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 135065168 |
| Molecular Formula | C24H24O7 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 2-[2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-4-methoxy-6-[(E)-3-oxo-3-phenylmethoxyprop-1-enyl]phenyl]acetic acid |
| SMILES | CCOC(=O)/C=C/c1cc(OC)cc(/C=C/C(=O)OCc2ccccc2)c1CC(=O)O |
| InChI | InChI=1S/C24H24O7/c1-3-30-23(27)11-9-18-13-20(29-2)14-19(21(18)15-22(25)26)10-12-24(28)31-16-17-7-5-4-6-8-17/h4-14H,3,15-16H2,1-2H3,(H,25,26)/b11-9+,12-10+ |
| InChIKey | FJKQUJUEFNYCCB-WGDLNXRISA-N |
| XLogP | 3.66 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|