C29H23F3O3S — CID 135065172
[4-(1,1,1-trifluoro-4,4-diphenylbut-3-en-2-yl)phenyl] 4-methylbenzenesulfonate (PubChem CID 135065172) has the molecular formula C29H23F3O3S and a molecular weight of 508.56 g/mol. Its IUPAC name is [4-(1,1,1-trifluoro-4,4-diphenylbut-3-en-2-yl)phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-(1,1,1-trifluoro-4,4-diphenylbut-3-en-2-yl)phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 135065172 |
| Molecular Formula | C29H23F3O3S |
| Molecular Weight | 508.56 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | [4-(1,1,1-trifluoro-4,4-diphenylbut-3-en-2-yl)phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(C(C=C(c3ccccc3)c3ccccc3)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C29H23F3O3S/c1-21-12-18-26(19-13-21)36(33,34)35-25-16-14-24(15-17-25)28(29(30,31)32)20-27(22-8-4-2-5-9-22)23-10-6-3-7-11-23/h2-20,28H,1H3 |
| InChIKey | WLDZBFYSMPQFOX-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.56 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|