About CID 135065233
CID 135065233 (PubChem CID 135065233) has the molecular formula C88H64N8O8PbS8+2
and a molecular weight of 1825.26 g/mol.
Molecular Properties
| Compound Name | CID 135065233 |
| PubChem CID | 135065233 |
| Molecular Formula | C88H64N8O8PbS8+2 |
| Molecular Weight | 1825.26 g/mol |
| Exact Mass | 1824.24 |
| IUPAC Name | — |
| SMILES | COc1ccc(Sc2ccc(Sc3ccc(OC)cc3)c3c2C2=N/C3=N\c3c4c(Sc5ccc(OC)cc5)ccc(Sc5ccc(OC)cc5)c4c4n3[Pb+2]n3/c(c5c(Sc6ccc(OC)cc6)ccc(Sc6ccc(OC)cc6)c5/c3=N/C3=N/C(=N\4)c4c(Sc5ccc(OC)cc5)ccc(Sc5ccc(OC)cc5)c43)=N\2)cc1 |
| InChI | InChI=1S/C88H64N8O8S8.Pb/c1-97-49-9-25-57(26-10-49)105-65-41-42-66(106-58-27-11-50(98-2)12-28-58)74-73(65)81-89-82(74)94-84-77-69(109-61-33-17-53(101-5)18-34-61)45-46-70(110-62-35-19-54(102-6)20-36-62)78(77)86(91-84)96-88-80-72(112-64-39-23-56(104-8)24-40-64)48-47-71(111-63-37-21-55(103-7)22-38-63)79(80)87(92-88)95-85-76-68(108-60-31-15-52(100-4)16-32-60)44-43-67(75(76)83(90-85)93-81)107-59-29-13-51(99-3)14-30-59;/h9-48H,1-8H3;/q-2;+4 |
| InChIKey | BGAYBDLNZIFKID-UHFFFAOYSA-N |
| XLogP | 21.75 |
| TPSA | 157.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 113 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1825.26 |
| LogP ≤ 5 | 21.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 24 |
Analyze CID 135065233 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 135065233?
The IUPAC name of CID 135065233 (CID 135065233) is not available.
What is the SMILES notation for CID 135065233?
The canonical SMILES for CID 135065233 is COc1ccc(Sc2ccc(Sc3ccc(OC)cc3)c3c2C2=N/C3=N\c3c4c(Sc5ccc(OC)cc5)ccc(Sc5ccc(OC)cc5)c4c4n3[Pb+2]n3/c(c5c(Sc6ccc(OC)cc6)ccc(Sc6ccc(OC)cc6)c5/c3=N/C3=N/C(=N\4)c4c(Sc5ccc(OC)cc5)ccc(Sc5ccc(OC)cc5)c43)=N\2)cc1.
What is the InChIKey of CID 135065233?
The InChIKey is BGAYBDLNZIFKID-UHFFFAOYSA-N. The full InChI is InChI=1S/C88H64N8O8S8.Pb/c1-97-49-9-25-57(26-10-49)105-65-41-42-66(106-58-27-11-50(98-2)12-28-58)74-73(65)81-89-82(74)94-84-77-69(109-61-33-17-53(101-5)18-34-61)45-46-70(110-62-35-19-54(102-6)20-36-62)78(77)86(91-84)96-88-80-72(112-64-39-23-56(104-8)24-40-64)48-47-71(111-63-37-21-55(103-7)22-38-63)79(80)87(92-88)95-85-76-68(108-60-31-15-52(100-4)16-32-60)44-43-67(75(76)83(90-85)93-81)107-59-29-13-51(99-3)14-30-59;/h9-48H,1-8H3;/q-2;+4.
What are the key properties of CID 135065233?
CID 135065233 has a molecular weight of 1825.26 g/mol, XLogP of 21.75, 24 rotatable bonds, 0 hydrogen bond donors, and 24 hydrogen bond acceptors.
Where does this data come from?
All data for CID 135065233 is sourced from PubChem (CID 135065233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).