About 10-(6-hydroxy-2,3,4-trimethylphenyl)phenothiazine-2-carbonitrile
10-(6-hydroxy-2,3,4-trimethylphenyl)phenothiazine-2-carbonitrile (PubChem CID 135065319) has the molecular formula C22H18N2OS
and a molecular weight of 358.47 g/mol. Its IUPAC name is 10-(6-hydroxy-2,3,4-trimethylphenyl)phenothiazine-2-carbonitrile.
Molecular Properties
| Compound Name | 10-(6-hydroxy-2,3,4-trimethylphenyl)phenothiazine-2-carbonitrile |
| PubChem CID | 135065319 |
| Molecular Formula | C22H18N2OS |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 10-(6-hydroxy-2,3,4-trimethylphenyl)phenothiazine-2-carbonitrile |
| SMILES | Cc1cc(O)c(N2c3ccccc3Sc3ccc(C#N)cc32)c(C)c1C |
| InChI | InChI=1S/C22H18N2OS/c1-13-10-19(25)22(15(3)14(13)2)24-17-6-4-5-7-20(17)26-21-9-8-16(12-23)11-18(21)24/h4-11,25H,1-3H3 |
| InChIKey | UURBSZYOGNKBDU-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 10-(6-hydroxy-2,3,4-trimethylphenyl)phenothiazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(6-hydroxy-2,3,4-trimethylphenyl)phenothiazine-2-carbonitrile?
The IUPAC name of 10-(6-hydroxy-2,3,4-trimethylphenyl)phenothiazine-2-carbonitrile (CID 135065319) is 10-(6-hydroxy-2,3,4-trimethylphenyl)phenothiazine-2-carbonitrile.
What is the SMILES notation for 10-(6-hydroxy-2,3,4-trimethylphenyl)phenothiazine-2-carbonitrile?
The canonical SMILES for 10-(6-hydroxy-2,3,4-trimethylphenyl)phenothiazine-2-carbonitrile is Cc1cc(O)c(N2c3ccccc3Sc3ccc(C#N)cc32)c(C)c1C.
What is the InChIKey of 10-(6-hydroxy-2,3,4-trimethylphenyl)phenothiazine-2-carbonitrile?
The InChIKey is UURBSZYOGNKBDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N2OS/c1-13-10-19(25)22(15(3)14(13)2)24-17-6-4-5-7-20(17)26-21-9-8-16(12-23)11-18(21)24/h4-11,25H,1-3H3.
What are the key properties of 10-(6-hydroxy-2,3,4-trimethylphenyl)phenothiazine-2-carbonitrile?
10-(6-hydroxy-2,3,4-trimethylphenyl)phenothiazine-2-carbonitrile has a molecular weight of 358.47 g/mol, XLogP of 6.12, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(6-hydroxy-2,3,4-trimethylphenyl)phenothiazine-2-carbonitrile is sourced from PubChem (CID 135065319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).