C28H38N2O3Si — CID 135065338
N-(2-pyridin-2-ylpropan-2-yl)-5-[2-tri(propan-2-yl)silylethynyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 135065338) has the molecular formula C28H38N2O3Si and a molecular weight of 478.71 g/mol. Its IUPAC name is N-(2-pyridin-2-ylpropan-2-yl)-5-[2-tri(propan-2-yl)silylethynyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-(2-pyridin-2-ylpropan-2-yl)-5-[2-tri(propan-2-yl)silylethynyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 135065338 |
| Molecular Formula | C28H38N2O3Si |
| Molecular Weight | 478.71 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | N-(2-pyridin-2-ylpropan-2-yl)-5-[2-tri(propan-2-yl)silylethynyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | CC(C)[Si](C#Cc1c(C(=O)NC(C)(C)c2ccccn2)ccc2c1OCCO2)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H38N2O3Si/c1-19(2)34(20(3)4,21(5)6)18-14-22-23(12-13-24-26(22)33-17-16-32-24)27(31)30-28(7,8)25-11-9-10-15-29-25/h9-13,15,19-21H,16-17H2,1-8H3,(H,30,31) |
| InChIKey | XHJIDTDKFHAKEF-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.71 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|