About methyl (2S,3R)-3-(4-nitrophenyl)-1,1-dioxothiolane-2-carboxylate
methyl (2S,3R)-3-(4-nitrophenyl)-1,1-dioxothiolane-2-carboxylate (PubChem CID 135065674) has the molecular formula C12H13NO6S
and a molecular weight of 299.30 g/mol. Its IUPAC name is methyl (2S,3R)-3-(4-nitrophenyl)-1,1-dioxothiolane-2-carboxylate.
Molecular Properties
| Compound Name | methyl (2S,3R)-3-(4-nitrophenyl)-1,1-dioxothiolane-2-carboxylate |
| PubChem CID | 135065674 |
| Molecular Formula | C12H13NO6S |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | methyl (2S,3R)-3-(4-nitrophenyl)-1,1-dioxothiolane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](c2ccc([N+](=O)[O-])cc2)CCS1(=O)=O |
| InChI | InChI=1S/C12H13NO6S/c1-19-12(14)11-10(6-7-20(11,17)18)8-2-4-9(5-3-8)13(15)16/h2-5,10-11H,6-7H2,1H3/t10-,11+/m1/s1 |
| InChIKey | AFANHWZYWWZXLR-MNOVXSKESA-N |
| XLogP | 1.04 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S,3R)-3-(4-nitrophenyl)-1,1-dioxothiolane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S,3R)-3-(4-nitrophenyl)-1,1-dioxothiolane-2-carboxylate?
The IUPAC name of methyl (2S,3R)-3-(4-nitrophenyl)-1,1-dioxothiolane-2-carboxylate (CID 135065674) is methyl (2S,3R)-3-(4-nitrophenyl)-1,1-dioxothiolane-2-carboxylate.
What is the SMILES notation for methyl (2S,3R)-3-(4-nitrophenyl)-1,1-dioxothiolane-2-carboxylate?
The canonical SMILES for methyl (2S,3R)-3-(4-nitrophenyl)-1,1-dioxothiolane-2-carboxylate is COC(=O)[C@@H]1[C@@H](c2ccc([N+](=O)[O-])cc2)CCS1(=O)=O.
What is the InChIKey of methyl (2S,3R)-3-(4-nitrophenyl)-1,1-dioxothiolane-2-carboxylate?
The InChIKey is AFANHWZYWWZXLR-MNOVXSKESA-N. The full InChI is InChI=1S/C12H13NO6S/c1-19-12(14)11-10(6-7-20(11,17)18)8-2-4-9(5-3-8)13(15)16/h2-5,10-11H,6-7H2,1H3/t10-,11+/m1/s1.
What are the key properties of methyl (2S,3R)-3-(4-nitrophenyl)-1,1-dioxothiolane-2-carboxylate?
methyl (2S,3R)-3-(4-nitrophenyl)-1,1-dioxothiolane-2-carboxylate has a molecular weight of 299.30 g/mol, XLogP of 1.04, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S,3R)-3-(4-nitrophenyl)-1,1-dioxothiolane-2-carboxylate is sourced from PubChem (CID 135065674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).