C13H9F7 — CID 135065691
1,2,4,5-tetrafluoro-3-hex-1-ynyl-6-(trifluoromethyl)benzene (PubChem CID 135065691) has the molecular formula C13H9F7 and a molecular weight of 298.20 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-hex-1-ynyl-6-(trifluoromethyl)benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-hex-1-ynyl-6-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 135065691 |
| Molecular Formula | C13H9F7 |
| Molecular Weight | 298.20 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-hex-1-ynyl-6-(trifluoromethyl)benzene |
| SMILES | CCCCC#Cc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C13H9F7/c1-2-3-4-5-6-7-9(14)11(16)8(13(18,19)20)12(17)10(7)15/h2-4H2,1H3 |
| InChIKey | LTYBYEPLMBBKJZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.20 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|