C22H35NO4Si — CID 135065742
(4S)-4-benzyl-3-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanoyl]-1,3-oxazolidin-2-one (PubChem CID 135065742) has the molecular formula C22H35NO4Si and a molecular weight of 405.61 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 135065742 |
| Molecular Formula | C22H35NO4Si |
| Molecular Weight | 405.61 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | (4S)-4-benzyl-3-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanoyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)[C@@H](CC(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H35NO4Si/c1-16(2)19(27-28(6,7)22(3,4)5)14-20(24)23-18(15-26-21(23)25)13-17-11-9-8-10-12-17/h8-12,16,18-19H,13-15H2,1-7H3/t18-,19+/m0/s1 |
| InChIKey | HTJJCAMGVSLTFC-RBUKOAKNSA-N |
| XLogP | 5.01 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.61 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|