About 5-N-(4-methoxyphenyl)-3-N-[2-(trifluoromethyl)phenyl]-1H-pyrazole-3,5-diamine
5-N-(4-methoxyphenyl)-3-N-[2-(trifluoromethyl)phenyl]-1H-pyrazole-3,5-diamine (PubChem CID 135066066) has the molecular formula C17H15F3N4O
and a molecular weight of 348.33 g/mol. Its IUPAC name is 5-N-(4-methoxyphenyl)-3-N-[2-(trifluoromethyl)phenyl]-1H-pyrazole-3,5-diamine.
Molecular Properties
| Compound Name | 5-N-(4-methoxyphenyl)-3-N-[2-(trifluoromethyl)phenyl]-1H-pyrazole-3,5-diamine |
| PubChem CID | 135066066 |
| Molecular Formula | C17H15F3N4O |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 5-N-(4-methoxyphenyl)-3-N-[2-(trifluoromethyl)phenyl]-1H-pyrazole-3,5-diamine |
| SMILES | COc1ccc(Nc2cc(Nc3ccccc3C(F)(F)F)n[nH]2)cc1 |
| InChI | InChI=1S/C17H15F3N4O/c1-25-12-8-6-11(7-9-12)21-15-10-16(24-23-15)22-14-5-3-2-4-13(14)17(18,19)20/h2-10H,1H3,(H3,21,22,23,24) |
| InChIKey | MHXFTWDVYKEUKX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 61.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-N-(4-methoxyphenyl)-3-N-[2-(trifluoromethyl)phenyl]-1H-pyrazole-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-(4-methoxyphenyl)-3-N-[2-(trifluoromethyl)phenyl]-1H-pyrazole-3,5-diamine?
The IUPAC name of 5-N-(4-methoxyphenyl)-3-N-[2-(trifluoromethyl)phenyl]-1H-pyrazole-3,5-diamine (CID 135066066) is 5-N-(4-methoxyphenyl)-3-N-[2-(trifluoromethyl)phenyl]-1H-pyrazole-3,5-diamine.
What is the SMILES notation for 5-N-(4-methoxyphenyl)-3-N-[2-(trifluoromethyl)phenyl]-1H-pyrazole-3,5-diamine?
The canonical SMILES for 5-N-(4-methoxyphenyl)-3-N-[2-(trifluoromethyl)phenyl]-1H-pyrazole-3,5-diamine is COc1ccc(Nc2cc(Nc3ccccc3C(F)(F)F)n[nH]2)cc1.
What is the InChIKey of 5-N-(4-methoxyphenyl)-3-N-[2-(trifluoromethyl)phenyl]-1H-pyrazole-3,5-diamine?
The InChIKey is MHXFTWDVYKEUKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F3N4O/c1-25-12-8-6-11(7-9-12)21-15-10-16(24-23-15)22-14-5-3-2-4-13(14)17(18,19)20/h2-10H,1H3,(H3,21,22,23,24).
What are the key properties of 5-N-(4-methoxyphenyl)-3-N-[2-(trifluoromethyl)phenyl]-1H-pyrazole-3,5-diamine?
5-N-(4-methoxyphenyl)-3-N-[2-(trifluoromethyl)phenyl]-1H-pyrazole-3,5-diamine has a molecular weight of 348.33 g/mol, XLogP of 4.92, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-(4-methoxyphenyl)-3-N-[2-(trifluoromethyl)phenyl]-1H-pyrazole-3,5-diamine is sourced from PubChem (CID 135066066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).