C19H21NO3 — CID 135066367
(4R)-4-phenyl-3-[(5E)-7-prop-2-enoxyhepta-1,2,5-trien-3-yl]-1,3-oxazolidin-2-one (PubChem CID 135066367) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is (4R)-4-phenyl-3-[(5E)-7-prop-2-enoxyhepta-1,2,5-trien-3-yl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-phenyl-3-[(5E)-7-prop-2-enoxyhepta-1,2,5-trien-3-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 135066367 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | (4R)-4-phenyl-3-[(5E)-7-prop-2-enoxyhepta-1,2,5-trien-3-yl]-1,3-oxazolidin-2-one |
| SMILES | C=C=C(C/C=C/COCC=C)N1C(=O)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H21NO3/c1-3-13-22-14-9-8-12-17(4-2)20-18(15-23-19(20)21)16-10-6-5-7-11-16/h3,5-11,18H,1-2,12-15H2/b9-8+/t18-/m0/s1 |
| InChIKey | FMFXSTVGBFXBEV-BLGFXRMMSA-N |
| XLogP | 4.00 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|