C20H25NO2 — CID 135066550
tert-butyl 2-(naphthalen-1-ylmethyl)pyrrolidine-1-carboxylate (PubChem CID 135066550) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is tert-butyl 2-(naphthalen-1-ylmethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(naphthalen-1-ylmethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 135066550 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | tert-butyl 2-(naphthalen-1-ylmethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C20H25NO2/c1-20(2,3)23-19(22)21-13-7-11-17(21)14-16-10-6-9-15-8-4-5-12-18(15)16/h4-6,8-10,12,17H,7,11,13-14H2,1-3H3 |
| InChIKey | KGQCOTVDXCRAPQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |