C13H21NO2 — CID 135066613
(5R,7R,8aS)-5-(cyclohexen-1-yl)-3,5,6,7,8,8a-hexahydro-1H-[1,3]oxazolo[3,4-a]pyridin-7-ol (PubChem CID 135066613) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is (5R,7R,8aS)-5-(cyclohexen-1-yl)-3,5,6,7,8,8a-hexahydro-1H-[1,3]oxazolo[3,4-a]pyridin-7-ol.
| Compound Name | (5R,7R,8aS)-5-(cyclohexen-1-yl)-3,5,6,7,8,8a-hexahydro-1H-[1,3]oxazolo[3,4-a]pyridin-7-ol |
|---|---|
| PubChem CID | 135066613 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | (5R,7R,8aS)-5-(cyclohexen-1-yl)-3,5,6,7,8,8a-hexahydro-1H-[1,3]oxazolo[3,4-a]pyridin-7-ol |
| SMILES | O[C@H]1C[C@H]2COCN2[C@@H](C2=CCCCC2)C1 |
| InChI | InChI=1S/C13H21NO2/c15-12-6-11-8-16-9-14(11)13(7-12)10-4-2-1-3-5-10/h4,11-13,15H,1-3,5-9H2/t11-,12-,13+/m0/s1 |
| InChIKey | ZSHWJUOPGYFUIO-RWMBFGLXSA-N |
| XLogP | 1.67 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|