C13H8BrF2NO2 — CID 135066630
N-(2-bromo-6-hydroxyphenyl)-2,6-difluorobenzamide (PubChem CID 135066630) has the molecular formula C13H8BrF2NO2 and a molecular weight of 328.11 g/mol. Its IUPAC name is N-(2-bromo-6-hydroxyphenyl)-2,6-difluorobenzamide.
| Compound Name | N-(2-bromo-6-hydroxyphenyl)-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 135066630 |
| Molecular Formula | C13H8BrF2NO2 |
| Molecular Weight | 328.11 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | N-(2-bromo-6-hydroxyphenyl)-2,6-difluorobenzamide |
| SMILES | O=C(Nc1c(O)cccc1Br)c1c(F)cccc1F |
| InChI | InChI=1S/C13H8BrF2NO2/c14-7-3-1-6-10(18)12(7)17-13(19)11-8(15)4-2-5-9(11)16/h1-6,18H,(H,17,19) |
| InChIKey | QKRVCZPSFSQBOL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.11 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|