C17H20O2S2 — CID 135066665
1,5-bis(phenylsulfanyl)pentane-2,4-diol (PubChem CID 135066665) has the molecular formula C17H20O2S2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 1,5-bis(phenylsulfanyl)pentane-2,4-diol.
| Compound Name | 1,5-bis(phenylsulfanyl)pentane-2,4-diol |
|---|---|
| PubChem CID | 135066665 |
| Molecular Formula | C17H20O2S2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 1,5-bis(phenylsulfanyl)pentane-2,4-diol |
| SMILES | OC(CSc1ccccc1)CC(O)CSc1ccccc1 |
| InChI | InChI=1S/C17H20O2S2/c18-14(12-20-16-7-3-1-4-8-16)11-15(19)13-21-17-9-5-2-6-10-17/h1-10,14-15,18-19H,11-13H2 |
| InChIKey | RAQXMPHKVJSQKO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |