C26H48O3Si2 — CID 135066673
triethyl-[(2E)-1-[3-(oxan-2-yloxy)prop-1-ynyl]-3-triethylsilylhexa-2,5-dienoxy]silane (PubChem CID 135066673) has the molecular formula C26H48O3Si2 and a molecular weight of 464.84 g/mol. Its IUPAC name is triethyl-[(2E)-1-[3-(oxan-2-yloxy)prop-1-ynyl]-3-triethylsilylhexa-2,5-dienoxy]silane.
| Compound Name | triethyl-[(2E)-1-[3-(oxan-2-yloxy)prop-1-ynyl]-3-triethylsilylhexa-2,5-dienoxy]silane |
|---|---|
| PubChem CID | 135066673 |
| Molecular Formula | C26H48O3Si2 |
| Molecular Weight | 464.84 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | triethyl-[(2E)-1-[3-(oxan-2-yloxy)prop-1-ynyl]-3-triethylsilylhexa-2,5-dienoxy]silane |
| SMILES | C=CC/C(=C\C(C#CCOC1CCCCO1)O[Si](CC)(CC)CC)[Si](CC)(CC)CC |
| InChI | InChI=1S/C26H48O3Si2/c1-8-18-25(30(9-2,10-3)11-4)23-24(29-31(12-5,13-6)14-7)19-17-22-28-26-20-15-16-21-27-26/h8,23-24,26H,1,9-16,18,20-22H2,2-7H3/b25-23+ |
| InChIKey | HOXSFQNGHSIGHS-WJTDDFOZSA-N |
| XLogP | 7.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.84 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|