C13H18O5 — CID 135066745
trans-1-O'-ethyl 1-O-methyl (3S,4R)-3-ethenyl-4-formylcyclopentane-1,1-dicarboxylate (PubChem CID 135066745) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is trans-1-O'-ethyl 1-O-methyl (3S,4R)-3-ethenyl-4-formylcyclopentane-1,1-dicarboxylate.
| Compound Name | trans-1-O'-ethyl 1-O-methyl (3S,4R)-3-ethenyl-4-formylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 135066745 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | trans-1-O'-ethyl 1-O-methyl (3S,4R)-3-ethenyl-4-formylcyclopentane-1,1-dicarboxylate |
| SMILES | C=C[C@@H]1CC(C(=O)OC)(C(=O)OCC)C[C@H]1C=O |
| InChI | InChI=1S/C13H18O5/c1-4-9-6-13(11(15)17-3,7-10(9)8-14)12(16)18-5-2/h4,8-10H,1,5-7H2,2-3H3/t9-,10+,13?/m1/s1 |
| InChIKey | UFAIROXRZVMJSR-GDVCOKDOSA-N |
| XLogP | 1.12 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|