C38H43NO7 — CID 135066768
3-O,4-O-dimethyl 2-O-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2R,5S)-1-(4-methoxyphenyl)-5-phenyl-2,5-dihydropyrrole-2,3,4-tricarboxylate (PubChem CID 135066768) has the molecular formula C38H43NO7 and a molecular weight of 625.76 g/mol. Its IUPAC name is 3-O,4-O-dimethyl 2-O-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2R,5S)-1-(4-methoxyphenyl)-5-phenyl-2,5-dihydropyrrole-2,3,4-tricarboxylate.
| Compound Name | 3-O,4-O-dimethyl 2-O-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2R,5S)-1-(4-methoxyphenyl)-5-phenyl-2,5-dihydropyrrole-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 135066768 |
| Molecular Formula | C38H43NO7 |
| Molecular Weight | 625.76 g/mol |
| Exact Mass | 625.30 |
| IUPAC Name | 3-O,4-O-dimethyl 2-O-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2R,5S)-1-(4-methoxyphenyl)-5-phenyl-2,5-dihydropyrrole-2,3,4-tricarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@H](c2ccccc2)N(c2ccc(OC)cc2)[C@H]1C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C38H43NO7/c1-24-17-22-29(38(2,3)26-15-11-8-12-16-26)30(23-24)46-37(42)34-32(36(41)45-6)31(35(40)44-5)33(25-13-9-7-10-14-25)39(34)27-18-20-28(43-4)21-19-27/h7-16,18-21,24,29-30,33-34H,17,22-23H2,1-6H3/t24-,29-,30-,33+,34-/m1/s1 |
| InChIKey | TZTABCQADZDISM-IDNFJDEPSA-N |
| XLogP | 6.59 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.76 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|