C37H40BrNO6 — CID 135066769
3-O,4-O-dimethyl 2-O-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2R,5S)-1-(4-bromophenyl)-5-phenyl-2,5-dihydropyrrole-2,3,4-tricarboxylate (PubChem CID 135066769) has the molecular formula C37H40BrNO6 and a molecular weight of 674.63 g/mol. Its IUPAC name is 3-O,4-O-dimethyl 2-O-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2R,5S)-1-(4-bromophenyl)-5-phenyl-2,5-dihydropyrrole-2,3,4-tricarboxylate.
| Compound Name | 3-O,4-O-dimethyl 2-O-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2R,5S)-1-(4-bromophenyl)-5-phenyl-2,5-dihydropyrrole-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 135066769 |
| Molecular Formula | C37H40BrNO6 |
| Molecular Weight | 674.63 g/mol |
| Exact Mass | 673.20 |
| IUPAC Name | 3-O,4-O-dimethyl 2-O-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2R,5S)-1-(4-bromophenyl)-5-phenyl-2,5-dihydropyrrole-2,3,4-tricarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@H](c2ccccc2)N(c2ccc(Br)cc2)[C@H]1C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C37H40BrNO6/c1-23-16-21-28(37(2,3)25-14-10-7-11-15-25)29(22-23)45-36(42)33-31(35(41)44-5)30(34(40)43-4)32(24-12-8-6-9-13-24)39(33)27-19-17-26(38)18-20-27/h6-15,17-20,23,28-29,32-33H,16,21-22H2,1-5H3/t23-,28-,29-,32+,33-/m1/s1 |
| InChIKey | UTHNUYDQLIWHOQ-SBYSMKLKSA-N |
| XLogP | 7.35 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.63 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|