C31H46O4Si — CID 135066881
tert-butyl-[3-[(2S,3S)-2-(4,4-dimethoxybutyl)-3-methyl-3,4-dihydro-2H-pyran-6-yl]propoxy]-diphenylsilane (PubChem CID 135066881) has the molecular formula C31H46O4Si and a molecular weight of 510.79 g/mol. Its IUPAC name is tert-butyl-[3-[(2S,3S)-2-(4,4-dimethoxybutyl)-3-methyl-3,4-dihydro-2H-pyran-6-yl]propoxy]-diphenylsilane.
| Compound Name | tert-butyl-[3-[(2S,3S)-2-(4,4-dimethoxybutyl)-3-methyl-3,4-dihydro-2H-pyran-6-yl]propoxy]-diphenylsilane |
|---|---|
| PubChem CID | 135066881 |
| Molecular Formula | C31H46O4Si |
| Molecular Weight | 510.79 g/mol |
| Exact Mass | 510.32 |
| IUPAC Name | tert-butyl-[3-[(2S,3S)-2-(4,4-dimethoxybutyl)-3-methyl-3,4-dihydro-2H-pyran-6-yl]propoxy]-diphenylsilane |
| SMILES | COC(CCC[C@@H]1OC(CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)=CC[C@@H]1C)OC |
| InChI | InChI=1S/C31H46O4Si/c1-25-22-23-26(35-29(25)20-13-21-30(32-5)33-6)15-14-24-34-36(31(2,3)4,27-16-9-7-10-17-27)28-18-11-8-12-19-28/h7-12,16-19,23,25,29-30H,13-15,20-22,24H2,1-6H3/t25-,29-/m0/s1 |
| InChIKey | CDJBCTOFHVERRN-SVEHJYQDSA-N |
| XLogP | 6.44 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.79 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|