C17H24O4 — CID 135066963
dimethyl (1R,5S,8S)-8-ethenyltricyclo[6.2.1.01,5]undecane-9,9-dicarboxylate (PubChem CID 135066963) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is dimethyl (1R,5S,8S)-8-ethenyltricyclo[6.2.1.01,5]undecane-9,9-dicarboxylate.
| Compound Name | dimethyl (1R,5S,8S)-8-ethenyltricyclo[6.2.1.01,5]undecane-9,9-dicarboxylate |
|---|---|
| PubChem CID | 135066963 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | dimethyl (1R,5S,8S)-8-ethenyltricyclo[6.2.1.01,5]undecane-9,9-dicarboxylate |
| SMILES | C=C[C@@]12CC[C@@H]3CCC[C@]3(CC1(C(=O)OC)C(=O)OC)C2 |
| InChI | InChI=1S/C17H24O4/c1-4-16-9-7-12-6-5-8-15(12,10-16)11-17(16,13(18)20-2)14(19)21-3/h4,12H,1,5-11H2,2-3H3/t12-,15+,16-/m0/s1 |
| InChIKey | MLQSKUKLIXPLLR-MAZHCROVSA-N |
| XLogP | 2.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|