C20H30O4 — CID 135066983
diethyl (1R,6R,9S)-9-ethenyltricyclo[7.2.1.01,6]dodecane-10,10-dicarboxylate (PubChem CID 135066983) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is diethyl (1R,6R,9S)-9-ethenyltricyclo[7.2.1.01,6]dodecane-10,10-dicarboxylate.
| Compound Name | diethyl (1R,6R,9S)-9-ethenyltricyclo[7.2.1.01,6]dodecane-10,10-dicarboxylate |
|---|---|
| PubChem CID | 135066983 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | diethyl (1R,6R,9S)-9-ethenyltricyclo[7.2.1.01,6]dodecane-10,10-dicarboxylate |
| SMILES | C=C[C@@]12CC[C@H]3CCCC[C@]3(CC1(C(=O)OCC)C(=O)OCC)C2 |
| InChI | InChI=1S/C20H30O4/c1-4-19-12-10-15-9-7-8-11-18(15,13-19)14-20(19,16(21)23-5-2)17(22)24-6-3/h4,15H,1,5-14H2,2-3H3/t15-,18-,19+/m1/s1 |
| InChIKey | WNMMOPWUPYZVOJ-LZQZEXGQSA-N |
| XLogP | 4.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|