C15H16F3NO3S — CID 135067095
1-[4-(trifluoromethyl)phenyl]sulfonyl-1-azaspiro[4.4]nonan-9-one (PubChem CID 135067095) has the molecular formula C15H16F3NO3S and a molecular weight of 347.36 g/mol. Its IUPAC name is 1-[4-(trifluoromethyl)phenyl]sulfonyl-1-azaspiro[4.4]nonan-9-one.
| Compound Name | 1-[4-(trifluoromethyl)phenyl]sulfonyl-1-azaspiro[4.4]nonan-9-one |
|---|---|
| PubChem CID | 135067095 |
| Molecular Formula | C15H16F3NO3S |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 1-[4-(trifluoromethyl)phenyl]sulfonyl-1-azaspiro[4.4]nonan-9-one |
| SMILES | O=C1CCCC12CCCN2S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H16F3NO3S/c16-15(17,18)11-4-6-12(7-5-11)23(21,22)19-10-2-9-14(19)8-1-3-13(14)20/h4-7H,1-3,8-10H2 |
| InChIKey | ILRNVFGZXKMRNC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |