About tert-butyl (1R,5R)-7-ethoxy-5-(4-methylphenyl)-2-oxo-8-oxabicyclo[3.2.1]oct-6-ene-1-carboxylate
tert-butyl (1R,5R)-7-ethoxy-5-(4-methylphenyl)-2-oxo-8-oxabicyclo[3.2.1]oct-6-ene-1-carboxylate (PubChem CID 135067177) has the molecular formula C21H26O5
and a molecular weight of 358.43 g/mol. Its IUPAC name is tert-butyl (1R,5R)-7-ethoxy-5-(4-methylphenyl)-2-oxo-8-oxabicyclo[3.2.1]oct-6-ene-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (1R,5R)-7-ethoxy-5-(4-methylphenyl)-2-oxo-8-oxabicyclo[3.2.1]oct-6-ene-1-carboxylate |
| PubChem CID | 135067177 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | tert-butyl (1R,5R)-7-ethoxy-5-(4-methylphenyl)-2-oxo-8-oxabicyclo[3.2.1]oct-6-ene-1-carboxylate |
| SMILES | CCOC1=C[C@@]2(c3ccc(C)cc3)CCC(=O)[C@]1(C(=O)OC(C)(C)C)O2 |
| InChI | InChI=1S/C21H26O5/c1-6-24-17-13-20(15-9-7-14(2)8-10-15)12-11-16(22)21(17,26-20)18(23)25-19(3,4)5/h7-10,13H,6,11-12H2,1-5H3/t20-,21+/m1/s1 |
| InChIKey | OZTFVAUVZHVMMY-RTWAWAEBSA-N |
| XLogP | 3.58 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (1R,5R)-7-ethoxy-5-(4-methylphenyl)-2-oxo-8-oxabicyclo[3.2.1]oct-6-ene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (1R,5R)-7-ethoxy-5-(4-methylphenyl)-2-oxo-8-oxabicyclo[3.2.1]oct-6-ene-1-carboxylate?
The IUPAC name of tert-butyl (1R,5R)-7-ethoxy-5-(4-methylphenyl)-2-oxo-8-oxabicyclo[3.2.1]oct-6-ene-1-carboxylate (CID 135067177) is tert-butyl (1R,5R)-7-ethoxy-5-(4-methylphenyl)-2-oxo-8-oxabicyclo[3.2.1]oct-6-ene-1-carboxylate.
What is the SMILES notation for tert-butyl (1R,5R)-7-ethoxy-5-(4-methylphenyl)-2-oxo-8-oxabicyclo[3.2.1]oct-6-ene-1-carboxylate?
The canonical SMILES for tert-butyl (1R,5R)-7-ethoxy-5-(4-methylphenyl)-2-oxo-8-oxabicyclo[3.2.1]oct-6-ene-1-carboxylate is CCOC1=C[C@@]2(c3ccc(C)cc3)CCC(=O)[C@]1(C(=O)OC(C)(C)C)O2.
What is the InChIKey of tert-butyl (1R,5R)-7-ethoxy-5-(4-methylphenyl)-2-oxo-8-oxabicyclo[3.2.1]oct-6-ene-1-carboxylate?
The InChIKey is OZTFVAUVZHVMMY-RTWAWAEBSA-N. The full InChI is InChI=1S/C21H26O5/c1-6-24-17-13-20(15-9-7-14(2)8-10-15)12-11-16(22)21(17,26-20)18(23)25-19(3,4)5/h7-10,13H,6,11-12H2,1-5H3/t20-,21+/m1/s1.
What are the key properties of tert-butyl (1R,5R)-7-ethoxy-5-(4-methylphenyl)-2-oxo-8-oxabicyclo[3.2.1]oct-6-ene-1-carboxylate?
tert-butyl (1R,5R)-7-ethoxy-5-(4-methylphenyl)-2-oxo-8-oxabicyclo[3.2.1]oct-6-ene-1-carboxylate has a molecular weight of 358.43 g/mol, XLogP of 3.58, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (1R,5R)-7-ethoxy-5-(4-methylphenyl)-2-oxo-8-oxabicyclo[3.2.1]oct-6-ene-1-carboxylate is sourced from PubChem (CID 135067177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).