C16H22O2 — CID 135067199
(1S,8R,11R,14R)-2,2,5-trimethyl-12-oxatetracyclo[6.5.1.04,14.011,14]tetradec-4-en-3-one (PubChem CID 135067199) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is (1S,8R,11R,14R)-2,2,5-trimethyl-12-oxatetracyclo[6.5.1.04,14.011,14]tetradec-4-en-3-one.
| Compound Name | (1S,8R,11R,14R)-2,2,5-trimethyl-12-oxatetracyclo[6.5.1.04,14.011,14]tetradec-4-en-3-one |
|---|---|
| PubChem CID | 135067199 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (1S,8R,11R,14R)-2,2,5-trimethyl-12-oxatetracyclo[6.5.1.04,14.011,14]tetradec-4-en-3-one |
| SMILES | CC1=C2C(=O)C(C)(C)[C@H]3CO[C@@H]4CC[C@@H](CC1)[C@]234 |
| InChI | InChI=1S/C16H22O2/c1-9-4-5-10-6-7-12-16(10)11(8-18-12)15(2,3)14(17)13(9)16/h10-12H,4-8H2,1-3H3/t10-,11-,12-,16+/m1/s1 |
| InChIKey | MVPQDYSSYCEZTD-QHSOUUPTSA-N |
| XLogP | 3.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |