C28H40O4Si — CID 135067260
(1R,4S,12E,14R)-12-(hydroxymethyl)-2,9,10-trimethylidene-4-[(1E,4Z)-6-methyl-5-trimethylsilylhepta-1,4,6-trienyl]-5,15-dioxabicyclo[12.1.0]pentadec-12-en-6-one (PubChem CID 135067260) has the molecular formula C28H40O4Si and a molecular weight of 468.71 g/mol. Its IUPAC name is (1R,4S,12E,14R)-12-(hydroxymethyl)-2,9,10-trimethylidene-4-[(1E,4Z)-6-methyl-5-trimethylsilylhepta-1,4,6-trienyl]-5,15-dioxabicyclo[12.1.0]pentadec-12-en-6-one.
| Compound Name | (1R,4S,12E,14R)-12-(hydroxymethyl)-2,9,10-trimethylidene-4-[(1E,4Z)-6-methyl-5-trimethylsilylhepta-1,4,6-trienyl]-5,15-dioxabicyclo[12.1.0]pentadec-12-en-6-one |
|---|---|
| PubChem CID | 135067260 |
| Molecular Formula | C28H40O4Si |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | (1R,4S,12E,14R)-12-(hydroxymethyl)-2,9,10-trimethylidene-4-[(1E,4Z)-6-methyl-5-trimethylsilylhepta-1,4,6-trienyl]-5,15-dioxabicyclo[12.1.0]pentadec-12-en-6-one |
| SMILES | C=C1CCC(=O)O[C@H](/C=C/C/C=C(/C(=C)C)[Si](C)(C)C)CC(=C)[C@H]2O[C@@H]2/C=C(/CO)CC1=C |
| InChI | InChI=1S/C28H40O4Si/c1-19(2)26(33(6,7)8)12-10-9-11-24-16-22(5)28-25(32-28)17-23(18-29)15-21(4)20(3)13-14-27(30)31-24/h9,11-12,17,24-25,28-29H,1,3-5,10,13-16,18H2,2,6-8H3/b11-9+,23-17+,26-12-/t24-,25-,28-/m1/s1 |
| InChIKey | QVUFPKKRAFFEID-YEOSYJFCSA-N |
| XLogP | 6.15 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|